C25H31N3O4 — CID 55965715
N-[1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidin-4-yl]-3-phenylpropanamide (PubChem CID 55965715) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 55965715 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[1-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperidin-4-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NC1CCN(C(=O)C2CCCCN2C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C25H31N3O4/c29-23(12-11-19-7-2-1-3-8-19)26-20-13-16-27(17-14-20)24(30)21-9-4-5-15-28(21)25(31)22-10-6-18-32-22/h1-3,6-8,10,18,20-21H,4-5,9,11-17H2,(H,26,29) |
| InChIKey | UTSKCCMZEPAALJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |