C20H29N3O5 — CID 55975170
tert-butyl 4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 55975170) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is tert-butyl 4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55975170 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | tert-butyl 4-[1-(furan-2-carbonyl)piperidine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C2CCCCN2C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H29N3O5/c1-20(2,3)28-19(26)22-12-10-21(11-13-22)17(24)15-7-4-5-9-23(15)18(25)16-8-6-14-27-16/h6,8,14-15H,4-5,7,9-13H2,1-3H3 |
| InChIKey | ZEXDJVJYZZGINE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |