C22H21ClFN3O2 — CID 86878648
1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(6-fluoro-1H-indol-3-yl)ethanone (PubChem CID 86878648) has the molecular formula C22H21ClFN3O2 and a molecular weight of 413.88 g/mol. Its IUPAC name is 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(6-fluoro-1H-indol-3-yl)ethanone.
| Compound Name | 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(6-fluoro-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 86878648 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-[4-(2-chlorobenzoyl)-1,4-diazepan-1-yl]-2-(6-fluoro-1H-indol-3-yl)ethanone |
| SMILES | O=C(Cc1c[nH]c2cc(F)ccc12)N1CCCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H21ClFN3O2/c23-19-5-2-1-4-18(19)22(29)27-9-3-8-26(10-11-27)21(28)12-15-14-25-20-13-16(24)6-7-17(15)20/h1-2,4-7,13-14,25H,3,8-12H2 |
| InChIKey | IDPVCDAOUTXREF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |