C19H17F3N2O2 — CID 110804269
1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 110804269) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110804269 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[4-(2,4-difluorobenzoyl)piperazin-1-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H17F3N2O2/c20-14-5-6-15(17(22)12-14)19(26)24-9-7-23(8-10-24)18(25)11-13-3-1-2-4-16(13)21/h1-6,12H,7-11H2 |
| InChIKey | UQJTYDJLZQMFGQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |