C13H19N3O2 — CID 61093702
(3,5-diaminophenyl)-(2,2-dimethylmorpholin-4-yl)methanone (PubChem CID 61093702) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is (3,5-diaminophenyl)-(2,2-dimethylmorpholin-4-yl)methanone.
| Compound Name | (3,5-diaminophenyl)-(2,2-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 61093702 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (3,5-diaminophenyl)-(2,2-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cc(N)cc(N)c2)CCO1 |
| InChI | InChI=1S/C13H19N3O2/c1-13(2)8-16(3-4-18-13)12(17)9-5-10(14)7-11(15)6-9/h5-7H,3-4,8,14-15H2,1-2H3 |
| InChIKey | MPNHJDIDAFIILC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|