C12H15FN2O2 — CID 61294351
(2,2-dimethylmorpholin-4-yl)-(2-fluoro-4-pyridinyl)methanone (PubChem CID 61294351) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is (2,2-dimethylmorpholin-4-yl)-(2-fluoro-4-pyridinyl)methanone.
| Compound Name | (2,2-dimethylmorpholin-4-yl)-(2-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 61294351 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2,2-dimethylmorpholin-4-yl)-(2-fluoro-4-pyridinyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccnc(F)c2)CCO1 |
| InChI | InChI=1S/C12H15FN2O2/c1-12(2)8-15(5-6-17-12)11(16)9-3-4-14-10(13)7-9/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | ZITWQFFJTYOLBU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|