About CID 70254735
CID 70254735 (PubChem CID 70254735) has the molecular formula C13H15BNO3
and a molecular weight of 244.08 g/mol.
Molecular Properties
| Compound Name | CID 70254735 |
| PubChem CID | 70254735 |
| Molecular Formula | C13H15BNO3 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | — |
| SMILES | C[B]c1cc(C(=O)O)cc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C13H15BNO3/c1-14-11-7-9(6-10(8-11)13(17)18)12(16)15-4-2-3-5-15/h6-8H,2-5H2,1H3,(H,17,18) |
| InChIKey | WNUJMQDGBJXJQT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70254735 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70254735?
The IUPAC name of CID 70254735 (CID 70254735) is not available.
What is the SMILES notation for CID 70254735?
The canonical SMILES for CID 70254735 is C[B]c1cc(C(=O)O)cc(C(=O)N2CCCC2)c1.
What is the InChIKey of CID 70254735?
The InChIKey is WNUJMQDGBJXJQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BNO3/c1-14-11-7-9(6-10(8-11)13(17)18)12(16)15-4-2-3-5-15/h6-8H,2-5H2,1H3,(H,17,18).
What are the key properties of CID 70254735?
CID 70254735 has a molecular weight of 244.08 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70254735 is sourced from PubChem (CID 70254735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).