C18H11F9N2O2 — CID 17110302
[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone (PubChem CID 17110302) has the molecular formula C18H11F9N2O2 and a molecular weight of 458.28 g/mol. Its IUPAC name is [4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone.
| Compound Name | [4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 17110302 |
| Molecular Formula | C18H11F9N2O2 |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | [4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methanone |
| SMILES | COc1c(F)c(F)c(C(=O)N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C18H11F9N2O2/c1-31-17-14(26)7(19)6(8(20)15(17)27)18(30)29-4-2-28(3-5-29)16-12(24)10(22)9(21)11(23)13(16)25/h2-5H2,1H3 |
| InChIKey | ZXCPOQSTEVATFL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|