C14H13F5INO2 — CID 172647598
(4,4-difluoropiperidin-1-yl)-[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methanone (PubChem CID 172647598) has the molecular formula C14H13F5INO2 and a molecular weight of 449.16 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 172647598 |
| Molecular Formula | C14H13F5INO2 |
| Molecular Weight | 449.16 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCC(F)(F)F)c(I)c1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H13F5INO2/c15-13(16)3-5-21(6-4-13)12(22)9-1-2-11(10(20)7-9)23-8-14(17,18)19/h1-2,7H,3-6,8H2 |
| InChIKey | ZBFKSPGAUIKINF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|