C15H20F2N2O — CID 155245200
(2-tert-butyl-4-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 155245200) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is (2-tert-butyl-4-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | (2-tert-butyl-4-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 155245200 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2-tert-butyl-4-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCC(F)(F)CC2)ccn1 |
| InChI | InChI=1S/C15H20F2N2O/c1-14(2,3)12-10-11(4-7-18-12)13(20)19-8-5-15(16,17)6-9-19/h4,7,10H,5-6,8-9H2,1-3H3 |
| InChIKey | TXYMMVXOHRVDPV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |