C13H11F5INO — CID 171921571
(4,4-difluoropiperidin-1-yl)-[4-iodo-2-(trifluoromethyl)phenyl]methanone (PubChem CID 171921571) has the molecular formula C13H11F5INO and a molecular weight of 419.13 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[4-iodo-2-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[4-iodo-2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 171921571 |
| Molecular Formula | C13H11F5INO |
| Molecular Weight | 419.13 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[4-iodo-2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(I)cc1C(F)(F)F)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H11F5INO/c14-12(15)3-5-20(6-4-12)11(21)9-2-1-8(19)7-10(9)13(16,17)18/h1-2,7H,3-6H2 |
| InChIKey | XWXDLCMBNVNVKC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.13 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|