C18H19F3N2O4 — CID 136549485
1-[4-[2-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]cyclobutane-1-carboxylic acid (PubChem CID 136549485) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 1-[4-[2-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[4-[2-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 136549485 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[4-[2-(trifluoromethyl)benzoyl]piperazine-1-carbonyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CCN(C(=O)C2(C(=O)O)CCC2)CC1 |
| InChI | InChI=1S/C18H19F3N2O4/c19-18(20,21)13-5-2-1-4-12(13)14(24)22-8-10-23(11-9-22)15(25)17(16(26)27)6-3-7-17/h1-2,4-5H,3,6-11H2,(H,26,27) |
| InChIKey | IDAHTEAGOMIGOX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|