C17H18F3NO3 — CID 146145502
1-[3-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]cyclobutane-1-carboxylic acid (PubChem CID 146145502) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is 1-[3-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[3-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 146145502 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[3-[2-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)N2CCC(c3ccccc3C(F)(F)F)C2)CCC1 |
| InChI | InChI=1S/C17H18F3NO3/c18-17(19,20)13-5-2-1-4-12(13)11-6-9-21(10-11)14(22)16(15(23)24)7-3-8-16/h1-2,4-5,11H,3,6-10H2,(H,23,24) |
| InChIKey | VRKMBMSLWNGFMX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|