C15H18F3N4O+ — CID 163928926
2,3-dihydro-1H-triazol-2-ium-4-yl-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone (PubChem CID 163928926) has the molecular formula C15H18F3N4O+ and a molecular weight of 327.33 g/mol. Its IUPAC name is 2,3-dihydro-1H-triazol-2-ium-4-yl-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone.
| Compound Name | 2,3-dihydro-1H-triazol-2-ium-4-yl-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 163928926 |
| Molecular Formula | C15H18F3N4O+ |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2,3-dihydro-1H-triazol-2-ium-4-yl-[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1=CN[NH2+]N1)N1CCC(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H17F3N4O/c16-15(17,18)12-4-2-1-3-11(12)10-5-7-22(8-6-10)14(23)13-9-19-21-20-13/h1-4,9-10,19-21H,5-8H2/p+1 |
| InChIKey | RGZXAUGKBZPLHW-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|