C20H22F4N2O3 — CID 172887761
1-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)benzoyl]-2,9-diazaspiro[4.5]decan-9-yl]prop-2-en-1-one (PubChem CID 172887761) has the molecular formula C20H22F4N2O3 and a molecular weight of 414.40 g/mol. Its IUPAC name is 1-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)benzoyl]-2,9-diazaspiro[4.5]decan-9-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)benzoyl]-2,9-diazaspiro[4.5]decan-9-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172887761 |
| Molecular Formula | C20H22F4N2O3 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-[2-[3-fluoro-4-(2,2,2-trifluoroethoxy)benzoyl]-2,9-diazaspiro[4.5]decan-9-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC2(CCN(C(=O)c3ccc(OCC(F)(F)F)c(F)c3)C2)C1 |
| InChI | InChI=1S/C20H22F4N2O3/c1-2-17(27)25-8-3-6-19(11-25)7-9-26(12-19)18(28)14-4-5-16(15(21)10-14)29-13-20(22,23)24/h2,4-5,10H,1,3,6-9,11-13H2 |
| InChIKey | BZPBPYYZSNKHGJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|