C14H19N5OS — CID 65359737
(4-amino-1-methylpyrazol-5-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 65359737) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is (4-amino-1-methylpyrazol-5-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (4-amino-1-methylpyrazol-5-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 65359737 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (4-amino-1-methylpyrazol-5-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cn1ncc(N)c1C(=O)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C14H19N5OS/c1-17-13(12(15)8-16-17)14(20)19-5-3-18(4-6-19)9-11-2-7-21-10-11/h2,7-8,10H,3-6,9,15H2,1H3 |
| InChIKey | DJKXLVWFDIJDPC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |