C21H26N2O2S — CID 3853424
1-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]-2-(2,4,6-trimethylphenyl)ethane-1,2-dione (PubChem CID 3853424) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]-2-(2,4,6-trimethylphenyl)ethane-1,2-dione.
| Compound Name | 1-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]-2-(2,4,6-trimethylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 3853424 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]-2-(2,4,6-trimethylphenyl)ethane-1,2-dione |
| SMILES | Cc1cc(C)c(C(=O)C(=O)N2CCCN(Cc3ccsc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-15-11-16(2)19(17(3)12-15)20(24)21(25)23-7-4-6-22(8-9-23)13-18-5-10-26-14-18/h5,10-12,14H,4,6-9,13H2,1-3H3 |
| InChIKey | SAPUTYZAADJBQN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|