C13H21BrN2O2S — CID 156599384
ethyl 4-methyl-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carboxylate bromide (PubChem CID 156599384) has the molecular formula C13H21BrN2O2S and a molecular weight of 349.29 g/mol. Its IUPAC name is ethyl 4-methyl-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carboxylate bromide.
| Compound Name | ethyl 4-methyl-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carboxylate bromide |
|---|---|
| PubChem CID | 156599384 |
| Molecular Formula | C13H21BrN2O2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | ethyl 4-methyl-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carboxylate bromide |
| SMILES | CCOC(=O)N1CC[N+](C)(Cc2ccsc2)CC1.[Br-] |
| InChI | InChI=1S/C13H21N2O2S.BrH/c1-3-17-13(16)14-5-7-15(2,8-6-14)10-12-4-9-18-11-12;/h4,9,11H,3,5-8,10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BYIZCPUVZIWXAW-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|