C22H25FN2O2S — CID 69412395
ethyl 4-[6-fluoro-1-(2-thiophen-3-ylethyl)indol-3-yl]piperidine-1-carboxylate (PubChem CID 69412395) has the molecular formula C22H25FN2O2S and a molecular weight of 400.52 g/mol. Its IUPAC name is ethyl 4-[6-fluoro-1-(2-thiophen-3-ylethyl)indol-3-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[6-fluoro-1-(2-thiophen-3-ylethyl)indol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69412395 |
| Molecular Formula | C22H25FN2O2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | ethyl 4-[6-fluoro-1-(2-thiophen-3-ylethyl)indol-3-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2cn(CCc3ccsc3)c3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C22H25FN2O2S/c1-2-27-22(26)24-10-6-17(7-11-24)20-14-25(9-5-16-8-12-28-15-16)21-13-18(23)3-4-19(20)21/h3-4,8,12-15,17H,2,5-7,9-11H2,1H3 |
| InChIKey | WDACEAVXVZFFPC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |