C15H22ClN2O2+ — CID 3030267
ethyl 4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-carboxylate (PubChem CID 3030267) has the molecular formula C15H22ClN2O2+ and a molecular weight of 297.81 g/mol. Its IUPAC name is ethyl 4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 3030267 |
| Molecular Formula | C15H22ClN2O2+ |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl 4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[N+](C)(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C15H22ClN2O2/c1-3-20-15(19)17-8-10-18(2,11-9-17)12-13-6-4-5-7-14(13)16/h4-7H,3,8-12H2,1-2H3/q+1 |
| InChIKey | ZQJMKBONHCJXNL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|