C14H18Cl2N2O2 — CID 91805200
(2,3-dichlorophenyl)methyl 4-ethylpiperazine-1-carboxylate (PubChem CID 91805200) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is (2,3-dichlorophenyl)methyl 4-ethylpiperazine-1-carboxylate.
| Compound Name | (2,3-dichlorophenyl)methyl 4-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 91805200 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (2,3-dichlorophenyl)methyl 4-ethylpiperazine-1-carboxylate |
| SMILES | CCN1CCN(C(=O)OCc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-2-17-6-8-18(9-7-17)14(19)20-10-11-4-3-5-12(15)13(11)16/h3-5H,2,6-10H2,1H3 |
| InChIKey | YSKSNRRMVGMYRC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |