C18H26F4N4OS — CID 86952141
2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 86952141) has the molecular formula C18H26F4N4OS and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86952141 |
| Molecular Formula | C18H26F4N4OS |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(CC(F)(F)C(F)F)CC1)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C18H26F4N4OS/c19-17(20)18(21,22)14-25-4-2-24(3-5-25)12-16(27)26-8-6-23(7-9-26)11-15-1-10-28-13-15/h1,10,13,17H,2-9,11-12,14H2 |
| InChIKey | LKYMREPGJYDCTQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|