C14H21ClN2OS — CID 54874778
5-chloro-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pentan-1-one (PubChem CID 54874778) has the molecular formula C14H21ClN2OS and a molecular weight of 300.85 g/mol. Its IUPAC name is 5-chloro-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-chloro-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 54874778 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-chloro-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCCl)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C14H21ClN2OS/c15-5-2-1-3-14(18)17-8-6-16(7-9-17)11-13-4-10-19-12-13/h4,10,12H,1-3,5-9,11H2 |
| InChIKey | XSVZGIXVYNKQLK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|