C20H23N3OS — CID 24505236
3-indol-1-yl-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propan-1-one (PubChem CID 24505236) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 3-indol-1-yl-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-indol-1-yl-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 24505236 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-indol-1-yl-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCn1ccc2ccccc21)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C20H23N3OS/c24-20(6-9-22-8-5-18-3-1-2-4-19(18)22)23-12-10-21(11-13-23)15-17-7-14-25-16-17/h1-5,7-8,14,16H,6,9-13,15H2 |
| InChIKey | ICTWJHUVQQSRJI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |