C23H25N3O2 — CID 36615779
1-(4-benzoyl-1,4-diazepan-1-yl)-3-indol-1-ylpropan-1-one (PubChem CID 36615779) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-(4-benzoyl-1,4-diazepan-1-yl)-3-indol-1-ylpropan-1-one.
| Compound Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-3-indol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 36615779 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-3-indol-1-ylpropan-1-one |
| SMILES | O=C(CCn1ccc2ccccc21)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O2/c27-22(12-16-24-15-11-19-7-4-5-10-21(19)24)25-13-6-14-26(18-17-25)23(28)20-8-2-1-3-9-20/h1-5,7-11,15H,6,12-14,16-18H2 |
| InChIKey | GQQCOZZOVHXOAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |