C18H20N6O2 — CID 134708113
2-indol-1-yl-1-[4-(2H-triazole-4-carbonyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 134708113) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-indol-1-yl-1-[4-(2H-triazole-4-carbonyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-indol-1-yl-1-[4-(2H-triazole-4-carbonyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 134708113 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-indol-1-yl-1-[4-(2H-triazole-4-carbonyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(Cn1ccc2ccccc21)N1CCCN(C(=O)c2cn[nH]n2)CC1 |
| InChI | InChI=1S/C18H20N6O2/c25-17(13-24-9-6-14-4-1-2-5-16(14)24)22-7-3-8-23(11-10-22)18(26)15-12-19-21-20-15/h1-2,4-6,9,12H,3,7-8,10-11,13H2,(H,19,20,21) |
| InChIKey | AAEBPPBVXMVIFK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |