C11H17NOS — CID 131084735
(3S,5R)-5-methyl-1-(thiophen-3-ylmethyl)piperidin-3-ol (PubChem CID 131084735) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is (3S,5R)-5-methyl-1-(thiophen-3-ylmethyl)piperidin-3-ol.
| Compound Name | (3S,5R)-5-methyl-1-(thiophen-3-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 131084735 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (3S,5R)-5-methyl-1-(thiophen-3-ylmethyl)piperidin-3-ol |
| SMILES | C[C@@H]1C[C@H](O)CN(Cc2ccsc2)C1 |
| InChI | InChI=1S/C11H17NOS/c1-9-4-11(13)7-12(5-9)6-10-2-3-14-8-10/h2-3,8-9,11,13H,4-7H2,1H3/t9-,11+/m1/s1 |
| InChIKey | GXMHLFRPGUKOQV-KOLCDFICSA-N |
| XLogP | 1.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |