C10H16N2OS — CID 130802814
(3S,5R)-5-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-ol (PubChem CID 130802814) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is (3S,5R)-5-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-ol.
| Compound Name | (3S,5R)-5-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 130802814 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3S,5R)-5-methyl-1-(1,3-thiazol-2-ylmethyl)piperidin-3-ol |
| SMILES | C[C@@H]1C[C@H](O)CN(Cc2nccs2)C1 |
| InChI | InChI=1S/C10H16N2OS/c1-8-4-9(13)6-12(5-8)7-10-11-2-3-14-10/h2-3,8-9,13H,4-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | UYXVABRXASMROI-BDAKNGLRSA-N |
| XLogP | 1.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |