C21H28N4OS — CID 125417566
(7R,8aS)-2-(2-phenylethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125417566) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is (7R,8aS)-2-(2-phenylethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aS)-2-(2-phenylethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125417566 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (7R,8aS)-2-(2-phenylethyl)-1'-(1,3-thiazol-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | O[C@@H]1C[C@H]2CN(CCc3ccccc3)CC3(CN(Cc4nccs4)C3)N2C1 |
| InChI | InChI=1S/C21H28N4OS/c26-19-10-18-11-23(8-6-17-4-2-1-3-5-17)14-21(25(18)12-19)15-24(16-21)13-20-22-7-9-27-20/h1-5,7,9,18-19,26H,6,8,10-16H2/t18-,19+/m0/s1 |
| InChIKey | JXHIGCPJENOVTJ-RBUKOAKNSA-N |
| XLogP | 1.69 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |