C20H29N3O — CID 163075788
2-benzyl-1'-(cyclopropylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 163075788) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-benzyl-1'-(cyclopropylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | 2-benzyl-1'-(cyclopropylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 163075788 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-benzyl-1'-(cyclopropylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | OC1CC2CN(Cc3ccccc3)CC3(CN(CC4CC4)C3)N2C1 |
| InChI | InChI=1S/C20H29N3O/c24-19-8-18-11-21(9-16-4-2-1-3-5-16)13-20(23(18)12-19)14-22(15-20)10-17-6-7-17/h1-5,17-19,24H,6-15H2 |
| InChIKey | MXHNCHIRGYOUQE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |