C19H28N4O — CID 125418176
(7R,8aS)-1'-cyclobutyl-2-(pyridin-3-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125418176) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (7R,8aS)-1'-cyclobutyl-2-(pyridin-3-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aS)-1'-cyclobutyl-2-(pyridin-3-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125418176 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (7R,8aS)-1'-cyclobutyl-2-(pyridin-3-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3cccnc3)CC3(CN(C4CCC4)C3)N2C1 |
| InChI | InChI=1S/C19H28N4O/c24-18-7-17-10-21(9-15-3-2-6-20-8-15)12-19(23(17)11-18)13-22(14-19)16-4-1-5-16/h2-3,6,8,16-18,24H,1,4-5,7,9-14H2/t17-,18+/m0/s1 |
| InChIKey | PBTSIJJSBRGSOP-ZWKOTPCHSA-N |
| XLogP | 0.94 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |