C23H25F3N4O2 — CID 162800115
[7-hydroxy-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-pyridin-3-ylmethanone (PubChem CID 162800115) has the molecular formula C23H25F3N4O2 and a molecular weight of 446.47 g/mol. Its IUPAC name is [7-hydroxy-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [7-hydroxy-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 162800115 |
| Molecular Formula | C23H25F3N4O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [7-hydroxy-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CC2CC(O)CN2C2(CN(Cc3ccc(C(F)(F)F)cc3)C2)C1 |
| InChI | InChI=1S/C23H25F3N4O2/c24-23(25,26)18-5-3-16(4-6-18)10-28-13-22(14-28)15-29(11-19-8-20(31)12-30(19)22)21(32)17-2-1-7-27-9-17/h1-7,9,19-20,31H,8,10-15H2 |
| InChIKey | LHKIBNMQXQZPLY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |