C18H26N4O2 — CID 162913241
(7-hydroxy-1'-propan-2-ylspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)-pyridin-3-ylmethanone (PubChem CID 162913241) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (7-hydroxy-1'-propan-2-ylspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)-pyridin-3-ylmethanone.
| Compound Name | (7-hydroxy-1'-propan-2-ylspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 162913241 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (7-hydroxy-1'-propan-2-ylspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)-pyridin-3-ylmethanone |
| SMILES | CC(C)N1CC2(CN(C(=O)c3cccnc3)CC3CC(O)CN32)C1 |
| InChI | InChI=1S/C18H26N4O2/c1-13(2)21-11-18(12-21)10-20(8-15-6-16(23)9-22(15)18)17(24)14-4-3-5-19-7-14/h3-5,7,13,15-16,23H,6,8-12H2,1-2H3 |
| InChIKey | VWIFXEMMPSJVOM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |