C24H29N3O3 — CID 125417135
3-[[(7R,8aR)-2-benzyl-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoic acid (PubChem CID 125417135) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[[(7R,8aR)-2-benzyl-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoic acid.
| Compound Name | 3-[[(7R,8aR)-2-benzyl-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 125417135 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-[[(7R,8aR)-2-benzyl-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CC3(CN(Cc4ccccc4)C[C@H]4C[C@@H](O)CN43)C2)c1 |
| InChI | InChI=1S/C24H29N3O3/c28-22-10-21-13-25(11-18-5-2-1-3-6-18)15-24(27(21)14-22)16-26(17-24)12-19-7-4-8-20(9-19)23(29)30/h1-9,21-22,28H,10-17H2,(H,29,30)/t21-,22-/m1/s1 |
| InChIKey | DZOUSXMSCQVQCX-FGZHOGPDSA-N |
| XLogP | 1.89 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |