C25H30F3N3O — CID 162800062
2-(2-phenylethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 162800062) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-(2-phenylethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | 2-(2-phenylethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 162800062 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-(2-phenylethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | OC1CC2CN(CCc3ccccc3)CC3(CN(Cc4ccc(C(F)(F)F)cc4)C3)N2C1 |
| InChI | InChI=1S/C25H30F3N3O/c26-25(27,28)21-8-6-20(7-9-21)13-30-17-24(18-30)16-29(11-10-19-4-2-1-3-5-19)14-22-12-23(32)15-31(22)24/h1-9,22-23,32H,10-18H2 |
| InChIKey | KRJPWYODPKGWDH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |