C22H28N4O — CID 125418490
(7R,8aR)-2-benzyl-1'-(pyridin-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125418490) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (7R,8aR)-2-benzyl-1'-(pyridin-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aR)-2-benzyl-1'-(pyridin-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125418490 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (7R,8aR)-2-benzyl-1'-(pyridin-2-ylmethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | O[C@@H]1C[C@@H]2CN(Cc3ccccc3)CC3(CN(Cc4ccccn4)C3)N2C1 |
| InChI | InChI=1S/C22H28N4O/c27-21-10-20-13-24(11-18-6-2-1-3-7-18)15-22(26(20)14-21)16-25(17-22)12-19-8-4-5-9-23-19/h1-9,20-21,27H,10-17H2/t20-,21-/m1/s1 |
| InChIKey | UOAUXLAXILLJDA-NHCUHLMSSA-N |
| XLogP | 1.59 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |