C25H33N3O — CID 125418789
(7R,8aR)-1',2-bis(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125418789) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is (7R,8aR)-1',2-bis(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aR)-1',2-bis(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125418789 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (7R,8aR)-1',2-bis(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | O[C@@H]1C[C@@H]2CN(CCc3ccccc3)CC3(CN(CCc4ccccc4)C3)N2C1 |
| InChI | InChI=1S/C25H33N3O/c29-24-15-23-16-26(13-11-21-7-3-1-4-8-21)18-25(28(23)17-24)19-27(20-25)14-12-22-9-5-2-6-10-22/h1-10,23-24,29H,11-20H2/t23-,24-/m1/s1 |
| InChIKey | ZYLHCAZPLPSWJK-DNQXCXABSA-N |
| XLogP | 2.28 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |