C20H31N3O2 — CID 125417868
(7R,8aR)-1'-(3-hydroxypropyl)-2-(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125417868) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (7R,8aR)-1'-(3-hydroxypropyl)-2-(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aR)-1'-(3-hydroxypropyl)-2-(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125417868 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (7R,8aR)-1'-(3-hydroxypropyl)-2-(2-phenylethyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | OCCCN1CC2(CN(CCc3ccccc3)C[C@H]3C[C@@H](O)CN32)C1 |
| InChI | InChI=1S/C20H31N3O2/c24-10-4-8-22-15-20(16-22)14-21(9-7-17-5-2-1-3-6-17)12-18-11-19(25)13-23(18)20/h1-3,5-6,18-19,24-25H,4,7-16H2/t18-,19-/m1/s1 |
| InChIKey | NGUCWUXQWKNELA-RTBURBONSA-N |
| XLogP | 0.42 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |