C20H27N3O4 — CID 125416802
1-[(7R,8aR)-7-hydroxy-1'-(2-phenylacetyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-3-hydroxypropan-1-one (PubChem CID 125416802) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-[(7R,8aR)-7-hydroxy-1'-(2-phenylacetyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-3-hydroxypropan-1-one.
| Compound Name | 1-[(7R,8aR)-7-hydroxy-1'-(2-phenylacetyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 125416802 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[(7R,8aR)-7-hydroxy-1'-(2-phenylacetyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]-3-hydroxypropan-1-one |
| SMILES | O=C(CCO)N1C[C@H]2C[C@@H](O)CN2C2(C1)CN(C(=O)Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H27N3O4/c24-7-6-18(26)21-10-16-9-17(25)11-23(16)20(12-21)13-22(14-20)19(27)8-15-4-2-1-3-5-15/h1-5,16-17,24-25H,6-14H2/t16-,17-/m1/s1 |
| InChIKey | ANHKYIANDUBYGT-IAGOWNOFSA-N |
| XLogP | -0.53 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |