C23H28FN3O — CID 125416784
(7R,8aR)-2-benzyl-1'-[(2-fluorophenyl)methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125416784) has the molecular formula C23H28FN3O and a molecular weight of 381.49 g/mol. Its IUPAC name is (7R,8aR)-2-benzyl-1'-[(2-fluorophenyl)methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aR)-2-benzyl-1'-[(2-fluorophenyl)methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125416784 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (7R,8aR)-2-benzyl-1'-[(2-fluorophenyl)methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | O[C@@H]1C[C@@H]2CN(Cc3ccccc3)CC3(CN(Cc4ccccc4F)C3)N2C1 |
| InChI | InChI=1S/C23H28FN3O/c24-22-9-5-4-8-19(22)12-26-16-23(17-26)15-25(11-18-6-2-1-3-7-18)13-20-10-21(28)14-27(20)23/h1-9,20-21,28H,10-17H2/t20-,21-/m1/s1 |
| InChIKey | ACZQANYCKWENJO-NHCUHLMSSA-N |
| XLogP | 2.33 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |