C23H27F3N4O — CID 125418664
(7R,8aS)-2-(pyridin-3-ylmethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol (PubChem CID 125418664) has the molecular formula C23H27F3N4O and a molecular weight of 432.49 g/mol. Its IUPAC name is (7R,8aS)-2-(pyridin-3-ylmethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol.
| Compound Name | (7R,8aS)-2-(pyridin-3-ylmethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
|---|---|
| PubChem CID | 125418664 |
| Molecular Formula | C23H27F3N4O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (7R,8aS)-2-(pyridin-3-ylmethyl)-1'-[[4-(trifluoromethyl)phenyl]methyl]spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-7-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3cccnc3)CC3(CN(Cc4ccc(C(F)(F)F)cc4)C3)N2C1 |
| InChI | InChI=1S/C23H27F3N4O/c24-23(25,26)19-5-3-17(4-6-19)10-29-15-22(16-29)14-28(11-18-2-1-7-27-9-18)12-20-8-21(31)13-30(20)22/h1-7,9,20-21,31H,8,10-16H2/t20-,21+/m0/s1 |
| InChIKey | XKBSDZZMVRBENA-LEWJYISDSA-N |
| XLogP | 2.61 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |