C21H31N3O4 — CID 125418507
methyl 3-[[(7R,8aS)-7-hydroxy-2-(3-hydroxypropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoate (PubChem CID 125418507) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is methyl 3-[[(7R,8aS)-7-hydroxy-2-(3-hydroxypropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoate.
| Compound Name | methyl 3-[[(7R,8aS)-7-hydroxy-2-(3-hydroxypropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoate |
|---|---|
| PubChem CID | 125418507 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | methyl 3-[[(7R,8aS)-7-hydroxy-2-(3-hydroxypropyl)spiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1'-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2CC3(CN(CCCO)C[C@@H]4C[C@@H](O)CN43)C2)c1 |
| InChI | InChI=1S/C21H31N3O4/c1-28-20(27)17-5-2-4-16(8-17)10-23-14-21(15-23)13-22(6-3-7-25)11-18-9-19(26)12-24(18)21/h2,4-5,8,18-19,25-26H,3,6-7,9-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | UXQANVYUJVTTBT-RBUKOAKNSA-N |
| XLogP | 0.16 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |