C25H28FN3O4 — CID 162905894
methyl 3-[1'-[(4-fluorophenyl)methyl]-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-carbonyl]benzoate (PubChem CID 162905894) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is methyl 3-[1'-[(4-fluorophenyl)methyl]-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-carbonyl]benzoate.
| Compound Name | methyl 3-[1'-[(4-fluorophenyl)methyl]-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-carbonyl]benzoate |
|---|---|
| PubChem CID | 162905894 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | methyl 3-[1'-[(4-fluorophenyl)methyl]-7-hydroxyspiro[1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-carbonyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)N2CC3CC(O)CN3C3(CN(Cc4ccc(F)cc4)C3)C2)c1 |
| InChI | InChI=1S/C25H28FN3O4/c1-33-24(32)19-4-2-3-18(9-19)23(31)28-12-21-10-22(30)13-29(21)25(16-28)14-27(15-25)11-17-5-7-20(26)8-6-17/h2-9,21-22,30H,10-16H2,1H3 |
| InChIKey | LSZQGWLECJDXMT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |