C14H15FN2S — CID 172891886
5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]-1,3-thiazole (PubChem CID 172891886) has the molecular formula C14H15FN2S and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 172891886 |
| Molecular Formula | C14H15FN2S |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]-1,3-thiazole |
| SMILES | Fc1ccc(C2CCN(Cc3cncs3)C2)cc1 |
| InChI | InChI=1S/C14H15FN2S/c15-13-3-1-11(2-4-13)12-5-6-17(8-12)9-14-7-16-10-18-14/h1-4,7,10,12H,5-6,8-9H2 |
| InChIKey | YDOWXFCPZHXWIX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |