C12H14N4S — CID 141207736
5-[(3-pyrimidin-2-ylpyrrolidin-1-yl)methyl]-1,3-thiazole (PubChem CID 141207736) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 5-[(3-pyrimidin-2-ylpyrrolidin-1-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(3-pyrimidin-2-ylpyrrolidin-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 141207736 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-[(3-pyrimidin-2-ylpyrrolidin-1-yl)methyl]-1,3-thiazole |
| SMILES | c1cnc(C2CCN(Cc3cncs3)C2)nc1 |
| InChI | InChI=1S/C12H14N4S/c1-3-14-12(15-4-1)10-2-5-16(7-10)8-11-6-13-9-17-11/h1,3-4,6,9-10H,2,5,7-8H2 |
| InChIKey | NGWAUTWOSNLNBM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |