C13H16N4S — CID 124980487
5-[[(3R)-3-pyrimidin-4-ylpiperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 124980487) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 5-[[(3R)-3-pyrimidin-4-ylpiperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 5-[[(3R)-3-pyrimidin-4-ylpiperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 124980487 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-[[(3R)-3-pyrimidin-4-ylpiperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | c1cc([C@@H]2CCCN(Cc3cncs3)C2)ncn1 |
| InChI | InChI=1S/C13H16N4S/c1-2-11(13-3-4-14-9-16-13)7-17(5-1)8-12-6-15-10-18-12/h3-4,6,9-11H,1-2,5,7-8H2/t11-/m1/s1 |
| InChIKey | MJEPKFLZEUHSHM-LLVKDONJSA-N |
| XLogP | 2.31 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |