C17H20FN3S — CID 74240292
2-ethylsulfanyl-5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyrimidine (PubChem CID 74240292) has the molecular formula C17H20FN3S and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyrimidine.
| Compound Name | 2-ethylsulfanyl-5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 74240292 |
| Molecular Formula | C17H20FN3S |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-ethylsulfanyl-5-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyrimidine |
| SMILES | CCSc1ncc(CN2CCC(c3ccc(F)cc3)C2)cn1 |
| InChI | InChI=1S/C17H20FN3S/c1-2-22-17-19-9-13(10-20-17)11-21-8-7-15(12-21)14-3-5-16(18)6-4-14/h3-6,9-10,15H,2,7-8,11-12H2,1H3 |
| InChIKey | NOWFSPXFNZLJFD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |