C18H21FN2 — CID 77097083
5-ethyl-2-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyridine (PubChem CID 77097083) has the molecular formula C18H21FN2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 5-ethyl-2-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyridine.
| Compound Name | 5-ethyl-2-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 77097083 |
| Molecular Formula | C18H21FN2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 5-ethyl-2-[[3-(4-fluorophenyl)pyrrolidin-1-yl]methyl]pyridine |
| SMILES | CCc1ccc(CN2CCC(c3ccc(F)cc3)C2)nc1 |
| InChI | InChI=1S/C18H21FN2/c1-2-14-3-8-18(20-11-14)13-21-10-9-16(12-21)15-4-6-17(19)7-5-15/h3-8,11,16H,2,9-10,12-13H2,1H3 |
| InChIKey | NAEWZTQYELOOSV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |