C12H17FN2O — CID 131891791
(3R,4R)-1-[(5-ethyl-2-pyridinyl)methyl]-4-fluoropyrrolidin-3-ol (PubChem CID 131891791) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is (3R,4R)-1-[(5-ethyl-2-pyridinyl)methyl]-4-fluoropyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-[(5-ethyl-2-pyridinyl)methyl]-4-fluoropyrrolidin-3-ol |
|---|---|
| PubChem CID | 131891791 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (3R,4R)-1-[(5-ethyl-2-pyridinyl)methyl]-4-fluoropyrrolidin-3-ol |
| SMILES | CCc1ccc(CN2C[C@@H](O)[C@H](F)C2)nc1 |
| InChI | InChI=1S/C12H17FN2O/c1-2-9-3-4-10(14-5-9)6-15-7-11(13)12(16)8-15/h3-5,11-12,16H,2,6-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | QXZZNOTVLPUKDY-VXGBXAGGSA-N |
| XLogP | 1.16 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |