C23H22N4OS — CID 23093836
N-(4-tert-butylphenyl)-2-[(2-cyano-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide (PubChem CID 23093836) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[(2-cyano-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[(2-cyano-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23093836 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[(2-cyano-4-pyridinyl)methylsulfanyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cccnc2SCc2ccnc(C#N)c2)cc1 |
| InChI | InChI=1S/C23H22N4OS/c1-23(2,3)17-6-8-18(9-7-17)27-21(28)20-5-4-11-26-22(20)29-15-16-10-12-25-19(13-16)14-24/h4-13H,15H2,1-3H3,(H,27,28) |
| InChIKey | QDTBWGUCTPQUMS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |